About S-[2-[(4-bromo-5-propan-2-ylpyrazolidine-3-carbonyl)amino]phenyl] N,N-dimethylcarbamothioate
S-[2-[(4-bromo-5-propan-2-ylpyrazolidine-3-carbonyl)amino]phenyl] N,N-dimethylcarbamothioate (PubChem CID 134007869) has the molecular formula C16H23BrN4O2S
and a molecular weight of 415.36 g/mol. Its IUPAC name is S-[2-[(4-bromo-5-propan-2-ylpyrazolidine-3-carbonyl)amino]phenyl] N,N-dimethylcarbamothioate.
Molecular Properties
| Compound Name | S-[2-[(4-bromo-5-propan-2-ylpyrazolidine-3-carbonyl)amino]phenyl] N,N-dimethylcarbamothioate |
| PubChem CID | 134007869 |
| Molecular Formula | C16H23BrN4O2S |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | S-[2-[(4-bromo-5-propan-2-ylpyrazolidine-3-carbonyl)amino]phenyl] N,N-dimethylcarbamothioate |
| SMILES | CC(C)C1NNC(C(=O)Nc2ccccc2SC(=O)N(C)C)C1Br |
| InChI | InChI=1S/C16H23BrN4O2S/c1-9(2)13-12(17)14(20-19-13)15(22)18-10-7-5-6-8-11(10)24-16(23)21(3)4/h5-9,12-14,19-20H,1-4H3,(H,18,22) |
| InChIKey | VKBXXCOEXXQEPK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[2-[(4-bromo-5-propan-2-ylpyrazolidine-3-carbonyl)amino]phenyl] N,N-dimethylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[2-[(4-bromo-5-propan-2-ylpyrazolidine-3-carbonyl)amino]phenyl] N,N-dimethylcarbamothioate?
The IUPAC name of S-[2-[(4-bromo-5-propan-2-ylpyrazolidine-3-carbonyl)amino]phenyl] N,N-dimethylcarbamothioate (CID 134007869) is S-[2-[(4-bromo-5-propan-2-ylpyrazolidine-3-carbonyl)amino]phenyl] N,N-dimethylcarbamothioate.
What is the SMILES notation for S-[2-[(4-bromo-5-propan-2-ylpyrazolidine-3-carbonyl)amino]phenyl] N,N-dimethylcarbamothioate?
The canonical SMILES for S-[2-[(4-bromo-5-propan-2-ylpyrazolidine-3-carbonyl)amino]phenyl] N,N-dimethylcarbamothioate is CC(C)C1NNC(C(=O)Nc2ccccc2SC(=O)N(C)C)C1Br.
What is the InChIKey of S-[2-[(4-bromo-5-propan-2-ylpyrazolidine-3-carbonyl)amino]phenyl] N,N-dimethylcarbamothioate?
The InChIKey is VKBXXCOEXXQEPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23BrN4O2S/c1-9(2)13-12(17)14(20-19-13)15(22)18-10-7-5-6-8-11(10)24-16(23)21(3)4/h5-9,12-14,19-20H,1-4H3,(H,18,22).
What are the key properties of S-[2-[(4-bromo-5-propan-2-ylpyrazolidine-3-carbonyl)amino]phenyl] N,N-dimethylcarbamothioate?
S-[2-[(4-bromo-5-propan-2-ylpyrazolidine-3-carbonyl)amino]phenyl] N,N-dimethylcarbamothioate has a molecular weight of 415.36 g/mol, XLogP of 2.66, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-[2-[(4-bromo-5-propan-2-ylpyrazolidine-3-carbonyl)amino]phenyl] N,N-dimethylcarbamothioate is sourced from PubChem (CID 134007869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).