C20H22N4O4 — CID 134008963
4-butoxy-N-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-6-yl)benzamide (PubChem CID 134008963) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is 4-butoxy-N-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-6-yl)benzamide.
| Compound Name | 4-butoxy-N-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-6-yl)benzamide |
|---|---|
| PubChem CID | 134008963 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 4-butoxy-N-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-6-yl)benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2cnc3c(c2)c(=O)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C20H22N4O4/c1-4-5-10-28-15-8-6-13(7-9-15)18(25)22-14-11-16-17(21-12-14)23(2)20(27)24(3)19(16)26/h6-9,11-12H,4-5,10H2,1-3H3,(H,22,25) |
| InChIKey | HBTWXJPKMBXYMZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|