C24H29N5O2 — CID 134009311
3-(1-adamantylcarbamoylamino)-N-(2-phenylpyrimidin-5-yl)propanamide (PubChem CID 134009311) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is 3-(1-adamantylcarbamoylamino)-N-(2-phenylpyrimidin-5-yl)propanamide.
| Compound Name | 3-(1-adamantylcarbamoylamino)-N-(2-phenylpyrimidin-5-yl)propanamide |
|---|---|
| PubChem CID | 134009311 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 3-(1-adamantylcarbamoylamino)-N-(2-phenylpyrimidin-5-yl)propanamide |
| SMILES | O=C(CCNC(=O)NC12CC3CC(CC(C3)C1)C2)Nc1cnc(-c2ccccc2)nc1 |
| InChI | InChI=1S/C24H29N5O2/c30-21(28-20-14-26-22(27-15-20)19-4-2-1-3-5-19)6-7-25-23(31)29-24-11-16-8-17(12-24)10-18(9-16)13-24/h1-5,14-18H,6-13H2,(H,28,30)(H2,25,29,31) |
| InChIKey | YFBKNAIGLMBGNE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |