C14H15N3S — CID 134010477
2-[1-(2-propan-2-ylphenyl)imidazol-2-yl]sulfanylacetonitrile (PubChem CID 134010477) has the molecular formula C14H15N3S and a molecular weight of 257.36 g/mol. Its IUPAC name is 2-[1-(2-propan-2-ylphenyl)imidazol-2-yl]sulfanylacetonitrile.
| Compound Name | 2-[1-(2-propan-2-ylphenyl)imidazol-2-yl]sulfanylacetonitrile |
|---|---|
| PubChem CID | 134010477 |
| Molecular Formula | C14H15N3S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 2-[1-(2-propan-2-ylphenyl)imidazol-2-yl]sulfanylacetonitrile |
| SMILES | CC(C)c1ccccc1-n1ccnc1SCC#N |
| InChI | InChI=1S/C14H15N3S/c1-11(2)12-5-3-4-6-13(12)17-9-8-16-14(17)18-10-7-15/h3-6,8-9,11H,10H2,1-2H3 |
| InChIKey | QAETVVZJLMWWQL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |