3,4-bis[[2-(2-chlorophenoxy)acetyl]amino]benzoic acid

C23H18Cl2N2O6 — CID 1340123

IUPAC3,4-bis[[2-(2-chlorophenoxy)acetyl]amino]benzoic acid
SMILESO=C(COc1ccccc1Cl)Nc1ccc(C(=O)O)cc1NC(=O)COc1ccccc1Cl
InChIInChI=1S/C23H18Cl2N2O6/c24-15-5-1-3-7-19(15)32-12-21(28)26-17-10-9-14(23(30)31)11-18(17)27-22(29)13-33-20-8-4-2-6-16(20)25/h1-11H,12-13H2,(H,26,28)(H,27,29)(H,30,31)
InChIKeyBBOGDFHKKHYYKH-UHFFFAOYSA-N
MW489.31 g/mol
LogP4.73
Rot. Bonds9

About 3,4-bis[[2-(2-chlorophenoxy)acetyl]amino]benzoic acid

3,4-bis[[2-(2-chlorophenoxy)acetyl]amino]benzoic acid (PubChem CID 1340123) has the molecular formula C23H18Cl2N2O6 and a molecular weight of 489.31 g/mol. Its IUPAC name is 3,4-bis[[2-(2-chlorophenoxy)acetyl]amino]benzoic acid.

Molecular Properties

Compound Name3,4-bis[[2-(2-chlorophenoxy)acetyl]amino]benzoic acid
PubChem CID1340123
Molecular FormulaC23H18Cl2N2O6
Molecular Weight489.31 g/mol
Exact Mass488.05
IUPAC Name3,4-bis[[2-(2-chlorophenoxy)acetyl]amino]benzoic acid
SMILESO=C(COc1ccccc1Cl)Nc1ccc(C(=O)O)cc1NC(=O)COc1ccccc1Cl
InChIInChI=1S/C23H18Cl2N2O6/c24-15-5-1-3-7-19(15)32-12-21(28)26-17-10-9-14(23(30)31)11-18(17)27-22(29)13-33-20-8-4-2-6-16(20)25/h1-11H,12-13H2,(H,26,28)(H,27,29)(H,30,31)
InChIKeyBBOGDFHKKHYYKH-UHFFFAOYSA-N
XLogP4.73
TPSA113.96 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds9
Heavy Atoms33
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500489.31
LogP ≤ 54.73
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 3,4-bis[[2-(2-chlorophenoxy)acetyl]amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,4-bis[[2-(2-chlorophenoxy)acetyl]amino]benzoic acid?
The IUPAC name of 3,4-bis[[2-(2-chlorophenoxy)acetyl]amino]benzoic acid (CID 1340123) is 3,4-bis[[2-(2-chlorophenoxy)acetyl]amino]benzoic acid.
What is the SMILES notation for 3,4-bis[[2-(2-chlorophenoxy)acetyl]amino]benzoic acid?
The canonical SMILES for 3,4-bis[[2-(2-chlorophenoxy)acetyl]amino]benzoic acid is O=C(COc1ccccc1Cl)Nc1ccc(C(=O)O)cc1NC(=O)COc1ccccc1Cl.
What is the InChIKey of 3,4-bis[[2-(2-chlorophenoxy)acetyl]amino]benzoic acid?
The InChIKey is BBOGDFHKKHYYKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18Cl2N2O6/c24-15-5-1-3-7-19(15)32-12-21(28)26-17-10-9-14(23(30)31)11-18(17)27-22(29)13-33-20-8-4-2-6-16(20)25/h1-11H,12-13H2,(H,26,28)(H,27,29)(H,30,31).
What are the key properties of 3,4-bis[[2-(2-chlorophenoxy)acetyl]amino]benzoic acid?
3,4-bis[[2-(2-chlorophenoxy)acetyl]amino]benzoic acid has a molecular weight of 489.31 g/mol, XLogP of 4.73, 9 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis[[2-(2-chlorophenoxy)acetyl]amino]benzoic acid is sourced from PubChem (CID 1340123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).