C15H19Cl2NO — CID 134014985
N-[1-(3,4-dichlorophenyl)ethyl]-1-methylcyclopentane-1-carboxamide (PubChem CID 134014985) has the molecular formula C15H19Cl2NO and a molecular weight of 300.23 g/mol. Its IUPAC name is N-[1-(3,4-dichlorophenyl)ethyl]-1-methylcyclopentane-1-carboxamide.
| Compound Name | N-[1-(3,4-dichlorophenyl)ethyl]-1-methylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 134014985 |
| Molecular Formula | C15H19Cl2NO |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | N-[1-(3,4-dichlorophenyl)ethyl]-1-methylcyclopentane-1-carboxamide |
| SMILES | CC(NC(=O)C1(C)CCCC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H19Cl2NO/c1-10(11-5-6-12(16)13(17)9-11)18-14(19)15(2)7-3-4-8-15/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,18,19) |
| InChIKey | KJFWPNSENHKRBB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |