About 2-methylbuta-2,3-dienal
2-methylbuta-2,3-dienal (PubChem CID 13401730) has the molecular formula C5H6O
and a molecular weight of 82.10 g/mol. Its IUPAC name is 2-methylbuta-2,3-dienal.
Molecular Properties
| Compound Name | 2-methylbuta-2,3-dienal |
| PubChem CID | 13401730 |
| Molecular Formula | C5H6O |
| Molecular Weight | 82.10 g/mol |
| Exact Mass | 82.04 |
| IUPAC Name | 2-methylbuta-2,3-dienal |
| SMILES | C=C=C(C)C=O |
| InChI | InChI=1S/C5H6O/c1-3-5(2)4-6/h4H,1H2,2H3 |
| InChIKey | PCHLTWQCVLYYFN-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 82.10 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbuta-2,3-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbuta-2,3-dienal?
The IUPAC name of 2-methylbuta-2,3-dienal (CID 13401730) is 2-methylbuta-2,3-dienal.
What is the SMILES notation for 2-methylbuta-2,3-dienal?
The canonical SMILES for 2-methylbuta-2,3-dienal is C=C=C(C)C=O.
What is the InChIKey of 2-methylbuta-2,3-dienal?
The InChIKey is PCHLTWQCVLYYFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O/c1-3-5(2)4-6/h4H,1H2,2H3.
What are the key properties of 2-methylbuta-2,3-dienal?
2-methylbuta-2,3-dienal has a molecular weight of 82.10 g/mol, XLogP of 0.92, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbuta-2,3-dienal is sourced from PubChem (CID 13401730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).