C20H26N2OS — CID 134017459
1-[4-[(3-methylphenyl)methyl]piperazin-1-yl]-4-thiophen-2-ylbutan-1-one (PubChem CID 134017459) has the molecular formula C20H26N2OS and a molecular weight of 342.51 g/mol. Its IUPAC name is 1-[4-[(3-methylphenyl)methyl]piperazin-1-yl]-4-thiophen-2-ylbutan-1-one.
| Compound Name | 1-[4-[(3-methylphenyl)methyl]piperazin-1-yl]-4-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 134017459 |
| Molecular Formula | C20H26N2OS |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 1-[4-[(3-methylphenyl)methyl]piperazin-1-yl]-4-thiophen-2-ylbutan-1-one |
| SMILES | Cc1cccc(CN2CCN(C(=O)CCCc3cccs3)CC2)c1 |
| InChI | InChI=1S/C20H26N2OS/c1-17-5-2-6-18(15-17)16-21-10-12-22(13-11-21)20(23)9-3-7-19-8-4-14-24-19/h2,4-6,8,14-15H,3,7,9-13,16H2,1H3 |
| InChIKey | KTEJLWYTNLNFBZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |