About cyclohex-3-en-1-ylmethyl 2-(furan-2-yl)-1,3-thiazole-4-carboxylate
cyclohex-3-en-1-ylmethyl 2-(furan-2-yl)-1,3-thiazole-4-carboxylate (PubChem CID 134019054) has the molecular formula C15H15NO3S
and a molecular weight of 289.36 g/mol. Its IUPAC name is cyclohex-3-en-1-ylmethyl 2-(furan-2-yl)-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | cyclohex-3-en-1-ylmethyl 2-(furan-2-yl)-1,3-thiazole-4-carboxylate |
| PubChem CID | 134019054 |
| Molecular Formula | C15H15NO3S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | cyclohex-3-en-1-ylmethyl 2-(furan-2-yl)-1,3-thiazole-4-carboxylate |
| SMILES | O=C(OCC1CC=CCC1)c1csc(-c2ccco2)n1 |
| InChI | InChI=1S/C15H15NO3S/c17-15(19-9-11-5-2-1-3-6-11)12-10-20-14(16-12)13-7-4-8-18-13/h1-2,4,7-8,10-11H,3,5-6,9H2 |
| InChIKey | QOQVWGIEYJNKOS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclohex-3-en-1-ylmethyl 2-(furan-2-yl)-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohex-3-en-1-ylmethyl 2-(furan-2-yl)-1,3-thiazole-4-carboxylate?
The IUPAC name of cyclohex-3-en-1-ylmethyl 2-(furan-2-yl)-1,3-thiazole-4-carboxylate (CID 134019054) is cyclohex-3-en-1-ylmethyl 2-(furan-2-yl)-1,3-thiazole-4-carboxylate.
What is the SMILES notation for cyclohex-3-en-1-ylmethyl 2-(furan-2-yl)-1,3-thiazole-4-carboxylate?
The canonical SMILES for cyclohex-3-en-1-ylmethyl 2-(furan-2-yl)-1,3-thiazole-4-carboxylate is O=C(OCC1CC=CCC1)c1csc(-c2ccco2)n1.
What is the InChIKey of cyclohex-3-en-1-ylmethyl 2-(furan-2-yl)-1,3-thiazole-4-carboxylate?
The InChIKey is QOQVWGIEYJNKOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO3S/c17-15(19-9-11-5-2-1-3-6-11)12-10-20-14(16-12)13-7-4-8-18-13/h1-2,4,7-8,10-11H,3,5-6,9H2.
What are the key properties of cyclohex-3-en-1-ylmethyl 2-(furan-2-yl)-1,3-thiazole-4-carboxylate?
cyclohex-3-en-1-ylmethyl 2-(furan-2-yl)-1,3-thiazole-4-carboxylate has a molecular weight of 289.36 g/mol, XLogP of 3.92, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohex-3-en-1-ylmethyl 2-(furan-2-yl)-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 134019054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).