C10H9N5S — CID 13402046
N,11-dimethyl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine (PubChem CID 13402046) has the molecular formula C10H9N5S and a molecular weight of 231.28 g/mol. Its IUPAC name is N,11-dimethyl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine.
| Compound Name | N,11-dimethyl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
|---|---|
| PubChem CID | 13402046 |
| Molecular Formula | C10H9N5S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | N,11-dimethyl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
| SMILES | CNc1nnnc2c1sc1nc(C)ccc12 |
| InChI | InChI=1S/C10H9N5S/c1-5-3-4-6-7-8(16-10(6)12-5)9(11-2)14-15-13-7/h3-4H,1-2H3,(H,11,13,14) |
| InChIKey | PVOFMUFFSPUQAH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |