C10H8N4S2 — CID 13402052
11-methyl-6-methylsulfanyl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 13402052) has the molecular formula C10H8N4S2 and a molecular weight of 248.34 g/mol. Its IUPAC name is 11-methyl-6-methylsulfanyl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 11-methyl-6-methylsulfanyl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 13402052 |
| Molecular Formula | C10H8N4S2 |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | 11-methyl-6-methylsulfanyl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | CSc1nnnc2c1sc1nc(C)ccc12 |
| InChI | InChI=1S/C10H8N4S2/c1-5-3-4-6-7-8(16-9(6)11-5)10(15-2)13-14-12-7/h3-4H,1-2H3 |
| InChIKey | VKLUMQAWLRGKNS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |