C19H28N2O4 — CID 134020580
(4-cyclopentylpiperazin-1-yl)-(2,4,5-trimethoxyphenyl)methanone (PubChem CID 134020580) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is (4-cyclopentylpiperazin-1-yl)-(2,4,5-trimethoxyphenyl)methanone.
| Compound Name | (4-cyclopentylpiperazin-1-yl)-(2,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 134020580 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | (4-cyclopentylpiperazin-1-yl)-(2,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(OC)c(C(=O)N2CCN(C3CCCC3)CC2)cc1OC |
| InChI | InChI=1S/C19H28N2O4/c1-23-16-13-18(25-3)17(24-2)12-15(16)19(22)21-10-8-20(9-11-21)14-6-4-5-7-14/h12-14H,4-11H2,1-3H3 |
| InChIKey | VUVMQIKLTQWMKR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |