C18H24N2O3 — CID 134021879
ethyl (2S,3S,4S)-4-acetamido-3-phenyl-1-prop-2-enylpyrrolidine-2-carboxylate (PubChem CID 134021879) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is ethyl (2S,3S,4S)-4-acetamido-3-phenyl-1-prop-2-enylpyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S,3S,4S)-4-acetamido-3-phenyl-1-prop-2-enylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 134021879 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | ethyl (2S,3S,4S)-4-acetamido-3-phenyl-1-prop-2-enylpyrrolidine-2-carboxylate |
| SMILES | C=CCN1C[C@@H](NC(C)=O)[C@H](c2ccccc2)[C@H]1C(=O)OCC |
| InChI | InChI=1S/C18H24N2O3/c1-4-11-20-12-15(19-13(3)21)16(14-9-7-6-8-10-14)17(20)18(22)23-5-2/h4,6-10,15-17H,1,5,11-12H2,2-3H3,(H,19,21)/t15-,16+,17+/m1/s1 |
| InChIKey | DPNKZOZPEKJZQJ-IKGGRYGDSA-N |
| XLogP | 1.71 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|