C27H25NO7S2 — CID 13402291
4-[1-butyl-4-(4-oxocyclohexa-2,5-dien-1-ylidene)-6-(4-sulfophenyl)-2-pyridinyl]benzenesulfonic acid (PubChem CID 13402291) has the molecular formula C27H25NO7S2 and a molecular weight of 539.63 g/mol. Its IUPAC name is 4-[1-butyl-4-(4-oxocyclohexa-2,5-dien-1-ylidene)-6-(4-sulfophenyl)-2-pyridinyl]benzenesulfonic acid.
| Compound Name | 4-[1-butyl-4-(4-oxocyclohexa-2,5-dien-1-ylidene)-6-(4-sulfophenyl)-2-pyridinyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 13402291 |
| Molecular Formula | C27H25NO7S2 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.11 |
| IUPAC Name | 4-[1-butyl-4-(4-oxocyclohexa-2,5-dien-1-ylidene)-6-(4-sulfophenyl)-2-pyridinyl]benzenesulfonic acid |
| SMILES | CCCCN1C(c2ccc(S(=O)(=O)O)cc2)=CC(=C2C=CC(=O)C=C2)C=C1c1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C27H25NO7S2/c1-2-3-16-28-26(20-6-12-24(13-7-20)36(30,31)32)17-22(19-4-10-23(29)11-5-19)18-27(28)21-8-14-25(15-9-21)37(33,34)35/h4-15,17-18H,2-3,16H2,1H3,(H,30,31,32)(H,33,34,35) |
| InChIKey | BJYCBVTVOLTMEA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|