C15H23NO — CID 134024126
2-methyl-N-[1-(4-methylphenyl)propyl]butanamide (PubChem CID 134024126) has the molecular formula C15H23NO and a molecular weight of 233.36 g/mol. Its IUPAC name is 2-methyl-N-[1-(4-methylphenyl)propyl]butanamide.
| Compound Name | 2-methyl-N-[1-(4-methylphenyl)propyl]butanamide |
|---|---|
| PubChem CID | 134024126 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 2-methyl-N-[1-(4-methylphenyl)propyl]butanamide |
| SMILES | CCC(C)C(=O)NC(CC)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H23NO/c1-5-12(4)15(17)16-14(6-2)13-9-7-11(3)8-10-13/h7-10,12,14H,5-6H2,1-4H3,(H,16,17) |
| InChIKey | UQOIOOPUUSYMPO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |