C16H20N4O4 — CID 134024394
ethyl 4-[3-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)propanoylamino]butanoate (PubChem CID 134024394) has the molecular formula C16H20N4O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is ethyl 4-[3-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)propanoylamino]butanoate.
| Compound Name | ethyl 4-[3-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)propanoylamino]butanoate |
|---|---|
| PubChem CID | 134024394 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | ethyl 4-[3-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)propanoylamino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)CCc1nc(-c2ccncc2)no1 |
| InChI | InChI=1S/C16H20N4O4/c1-2-23-15(22)4-3-9-18-13(21)5-6-14-19-16(20-24-14)12-7-10-17-11-8-12/h7-8,10-11H,2-6,9H2,1H3,(H,18,21) |
| InChIKey | LYMZGTXNHOMANY-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|