C22H20N2O7 — CID 1340250
5-[[2-(3-methylbutyl)-1,3-dioxoisoindole-5-carbonyl]amino]benzene-1,3-dicarboxylic acid (PubChem CID 1340250) has the molecular formula C22H20N2O7 and a molecular weight of 424.41 g/mol. Its IUPAC name is 5-[[2-(3-methylbutyl)-1,3-dioxoisoindole-5-carbonyl]amino]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[[2-(3-methylbutyl)-1,3-dioxoisoindole-5-carbonyl]amino]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 1340250 |
| Molecular Formula | C22H20N2O7 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 5-[[2-(3-methylbutyl)-1,3-dioxoisoindole-5-carbonyl]amino]benzene-1,3-dicarboxylic acid |
| SMILES | CC(C)CCN1C(=O)c2ccc(C(=O)Nc3cc(C(=O)O)cc(C(=O)O)c3)cc2C1=O |
| InChI | InChI=1S/C22H20N2O7/c1-11(2)5-6-24-19(26)16-4-3-12(10-17(16)20(24)27)18(25)23-15-8-13(21(28)29)7-14(9-15)22(30)31/h3-4,7-11H,5-6H2,1-2H3,(H,23,25)(H,28,29)(H,30,31) |
| InChIKey | WEHRMOWTHNLCTD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|