C24H25FN4O — CID 134025617
1-(4-fluorophenyl)-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]cyclobutane-1-carboxamide (PubChem CID 134025617) has the molecular formula C24H25FN4O and a molecular weight of 404.49 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]cyclobutane-1-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 134025617 |
| Molecular Formula | C24H25FN4O |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]cyclobutane-1-carboxamide |
| SMILES | O=C(Nc1cccc(-c2nnc3n2CCCCC3)c1)C1(c2ccc(F)cc2)CCC1 |
| InChI | InChI=1S/C24H25FN4O/c25-19-11-9-18(10-12-19)24(13-5-14-24)23(30)26-20-7-4-6-17(16-20)22-28-27-21-8-2-1-3-15-29(21)22/h4,6-7,9-12,16H,1-3,5,8,13-15H2,(H,26,30) |
| InChIKey | OMSJUVGGYDVKSY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |