C17H19NO — CID 134028664
N-ethyl-3,5-dimethyl-N-phenylbenzamide (PubChem CID 134028664) has the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. Its IUPAC name is N-ethyl-3,5-dimethyl-N-phenylbenzamide.
| Compound Name | N-ethyl-3,5-dimethyl-N-phenylbenzamide |
|---|---|
| PubChem CID | 134028664 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | N-ethyl-3,5-dimethyl-N-phenylbenzamide |
| SMILES | CCN(C(=O)c1cc(C)cc(C)c1)c1ccccc1 |
| InChI | InChI=1S/C17H19NO/c1-4-18(16-8-6-5-7-9-16)17(19)15-11-13(2)10-14(3)12-15/h5-12H,4H2,1-3H3 |
| InChIKey | SSLXCOFWNOQQJY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |