C24H36N2O3 — CID 134029878
azepan-1-yl-[1-[4-(3-methylbutoxy)benzoyl]piperidin-4-yl]methanone (PubChem CID 134029878) has the molecular formula C24H36N2O3 and a molecular weight of 400.56 g/mol. Its IUPAC name is azepan-1-yl-[1-[4-(3-methylbutoxy)benzoyl]piperidin-4-yl]methanone.
| Compound Name | azepan-1-yl-[1-[4-(3-methylbutoxy)benzoyl]piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 134029878 |
| Molecular Formula | C24H36N2O3 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.27 |
| IUPAC Name | azepan-1-yl-[1-[4-(3-methylbutoxy)benzoyl]piperidin-4-yl]methanone |
| SMILES | CC(C)CCOc1ccc(C(=O)N2CCC(C(=O)N3CCCCCC3)CC2)cc1 |
| InChI | InChI=1S/C24H36N2O3/c1-19(2)13-18-29-22-9-7-20(8-10-22)23(27)26-16-11-21(12-17-26)24(28)25-14-5-3-4-6-15-25/h7-10,19,21H,3-6,11-18H2,1-2H3 |
| InChIKey | DEWBGAOWWAQATL-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |