C19H19ClN2O3 — CID 134030385
N-(5-chloro-2-morpholin-4-ylphenyl)-2-(4-methylphenyl)-2-oxoacetamide (PubChem CID 134030385) has the molecular formula C19H19ClN2O3 and a molecular weight of 358.83 g/mol. Its IUPAC name is N-(5-chloro-2-morpholin-4-ylphenyl)-2-(4-methylphenyl)-2-oxoacetamide.
| Compound Name | N-(5-chloro-2-morpholin-4-ylphenyl)-2-(4-methylphenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 134030385 |
| Molecular Formula | C19H19ClN2O3 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | N-(5-chloro-2-morpholin-4-ylphenyl)-2-(4-methylphenyl)-2-oxoacetamide |
| SMILES | Cc1ccc(C(=O)C(=O)Nc2cc(Cl)ccc2N2CCOCC2)cc1 |
| InChI | InChI=1S/C19H19ClN2O3/c1-13-2-4-14(5-3-13)18(23)19(24)21-16-12-15(20)6-7-17(16)22-8-10-25-11-9-22/h2-7,12H,8-11H2,1H3,(H,21,24) |
| InChIKey | NNCCPXBGMGUEIK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|