C19H19FN2O3 — CID 134031178
(E)-3-[4-(2-amino-2-oxoethoxy)phenyl]-N-[2-(3-fluorophenyl)ethyl]prop-2-enamide (PubChem CID 134031178) has the molecular formula C19H19FN2O3 and a molecular weight of 342.37 g/mol. Its IUPAC name is (E)-3-[4-(2-amino-2-oxoethoxy)phenyl]-N-[2-(3-fluorophenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(2-amino-2-oxoethoxy)phenyl]-N-[2-(3-fluorophenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 134031178 |
| Molecular Formula | C19H19FN2O3 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | (E)-3-[4-(2-amino-2-oxoethoxy)phenyl]-N-[2-(3-fluorophenyl)ethyl]prop-2-enamide |
| SMILES | NC(=O)COc1ccc(/C=C/C(=O)NCCc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C19H19FN2O3/c20-16-3-1-2-15(12-16)10-11-22-19(24)9-6-14-4-7-17(8-5-14)25-13-18(21)23/h1-9,12H,10-11,13H2,(H2,21,23)(H,22,24)/b9-6+ |
| InChIKey | MTSUCHZWPYVABI-RMKNXTFCSA-N |
| XLogP | 2.06 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|