C18H18N6O4 — CID 134031476
6-methyl-N'-(4-nitrobenzoyl)-1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carbohydrazide (PubChem CID 134031476) has the molecular formula C18H18N6O4 and a molecular weight of 382.38 g/mol. Its IUPAC name is 6-methyl-N'-(4-nitrobenzoyl)-1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carbohydrazide.
| Compound Name | 6-methyl-N'-(4-nitrobenzoyl)-1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carbohydrazide |
|---|---|
| PubChem CID | 134031476 |
| Molecular Formula | C18H18N6O4 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 6-methyl-N'-(4-nitrobenzoyl)-1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carbohydrazide |
| SMILES | Cc1nc2c(cnn2C(C)C)cc1C(=O)NNC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H18N6O4/c1-10(2)23-16-13(9-19-23)8-15(11(3)20-16)18(26)22-21-17(25)12-4-6-14(7-5-12)24(27)28/h4-10H,1-3H3,(H,21,25)(H,22,26) |
| InChIKey | XCBJAYMFVMUDIF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 132.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|