C14H18NO6P — CID 13403272
5-anilino-3,3,8,8-tetramethyl-1,4,6,9-tetraoxa-5lambda5-phosphaspiro[4.4]nonane-2,7-dione (PubChem CID 13403272) has the molecular formula C14H18NO6P and a molecular weight of 327.27 g/mol. Its IUPAC name is 5-anilino-3,3,8,8-tetramethyl-1,4,6,9-tetraoxa-5lambda5-phosphaspiro[4.4]nonane-2,7-dione.
| Compound Name | 5-anilino-3,3,8,8-tetramethyl-1,4,6,9-tetraoxa-5lambda5-phosphaspiro[4.4]nonane-2,7-dione |
|---|---|
| PubChem CID | 13403272 |
| Molecular Formula | C14H18NO6P |
| Molecular Weight | 327.27 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 5-anilino-3,3,8,8-tetramethyl-1,4,6,9-tetraoxa-5lambda5-phosphaspiro[4.4]nonane-2,7-dione |
| SMILES | CC1(C)OP2(Nc3ccccc3)(OC1=O)OC(=O)C(C)(C)O2 |
| InChI | InChI=1S/C14H18NO6P/c1-13(2)11(16)18-22(20-13,15-10-8-6-5-7-9-10)19-12(17)14(3,4)21-22/h5-9,15H,1-4H3 |
| InChIKey | PRVQDNIGBLMTCD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|