C19H24FN3O3S — CID 134033944
tert-butyl N-[4-[[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]amino]-4-oxobutyl]carbamate (PubChem CID 134033944) has the molecular formula C19H24FN3O3S and a molecular weight of 393.48 g/mol. Its IUPAC name is tert-butyl N-[4-[[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]amino]-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[4-[[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]amino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 134033944 |
| Molecular Formula | C19H24FN3O3S |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | tert-butyl N-[4-[[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]amino]-4-oxobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)Nc1ncc(Cc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C19H24FN3O3S/c1-19(2,3)26-18(25)21-10-4-5-16(24)23-17-22-12-15(27-17)11-13-6-8-14(20)9-7-13/h6-9,12H,4-5,10-11H2,1-3H3,(H,21,25)(H,22,23,24) |
| InChIKey | OUZMMRYDWZSKPF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|