C24H31NO3 — CID 134034068
1-(6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-phenylpentan-1-one (PubChem CID 134034068) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is 1-(6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-phenylpentan-1-one.
| Compound Name | 1-(6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-phenylpentan-1-one |
|---|---|
| PubChem CID | 134034068 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | 1-(6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-phenylpentan-1-one |
| SMILES | CCCC(C(=O)N1CCc2cc(OCC)c(OCC)cc2C1)c1ccccc1 |
| InChI | InChI=1S/C24H31NO3/c1-4-10-21(18-11-8-7-9-12-18)24(26)25-14-13-19-15-22(27-5-2)23(28-6-3)16-20(19)17-25/h7-9,11-12,15-16,21H,4-6,10,13-14,17H2,1-3H3 |
| InChIKey | LGULPJIDIRBXID-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |