About methyl 2-[[2-(3,4-difluorophenyl)sulfanylacetyl]amino]-2-methylpentanoate
methyl 2-[[2-(3,4-difluorophenyl)sulfanylacetyl]amino]-2-methylpentanoate (PubChem CID 134034513) has the molecular formula C15H19F2NO3S
and a molecular weight of 331.38 g/mol. Its IUPAC name is methyl 2-[[2-(3,4-difluorophenyl)sulfanylacetyl]amino]-2-methylpentanoate.
Molecular Properties
| Compound Name | methyl 2-[[2-(3,4-difluorophenyl)sulfanylacetyl]amino]-2-methylpentanoate |
| PubChem CID | 134034513 |
| Molecular Formula | C15H19F2NO3S |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | methyl 2-[[2-(3,4-difluorophenyl)sulfanylacetyl]amino]-2-methylpentanoate |
| SMILES | CCCC(C)(NC(=O)CSc1ccc(F)c(F)c1)C(=O)OC |
| InChI | InChI=1S/C15H19F2NO3S/c1-4-7-15(2,14(20)21-3)18-13(19)9-22-10-5-6-11(16)12(17)8-10/h5-6,8H,4,7,9H2,1-3H3,(H,18,19) |
| InChIKey | NFEZNFNSYYYSBA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[[2-(3,4-difluorophenyl)sulfanylacetyl]amino]-2-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[2-(3,4-difluorophenyl)sulfanylacetyl]amino]-2-methylpentanoate?
The IUPAC name of methyl 2-[[2-(3,4-difluorophenyl)sulfanylacetyl]amino]-2-methylpentanoate (CID 134034513) is methyl 2-[[2-(3,4-difluorophenyl)sulfanylacetyl]amino]-2-methylpentanoate.
What is the SMILES notation for methyl 2-[[2-(3,4-difluorophenyl)sulfanylacetyl]amino]-2-methylpentanoate?
The canonical SMILES for methyl 2-[[2-(3,4-difluorophenyl)sulfanylacetyl]amino]-2-methylpentanoate is CCCC(C)(NC(=O)CSc1ccc(F)c(F)c1)C(=O)OC.
What is the InChIKey of methyl 2-[[2-(3,4-difluorophenyl)sulfanylacetyl]amino]-2-methylpentanoate?
The InChIKey is NFEZNFNSYYYSBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19F2NO3S/c1-4-7-15(2,14(20)21-3)18-13(19)9-22-10-5-6-11(16)12(17)8-10/h5-6,8H,4,7,9H2,1-3H3,(H,18,19).
What are the key properties of methyl 2-[[2-(3,4-difluorophenyl)sulfanylacetyl]amino]-2-methylpentanoate?
methyl 2-[[2-(3,4-difluorophenyl)sulfanylacetyl]amino]-2-methylpentanoate has a molecular weight of 331.38 g/mol, XLogP of 2.90, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[2-(3,4-difluorophenyl)sulfanylacetyl]amino]-2-methylpentanoate is sourced from PubChem (CID 134034513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).