C18H13FN2OS — CID 134035410
N-[(4-cyanophenyl)methyl]-4-fluoro-3-methyl-1-benzothiophene-2-carboxamide (PubChem CID 134035410) has the molecular formula C18H13FN2OS and a molecular weight of 324.38 g/mol. Its IUPAC name is N-[(4-cyanophenyl)methyl]-4-fluoro-3-methyl-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(4-cyanophenyl)methyl]-4-fluoro-3-methyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 134035410 |
| Molecular Formula | C18H13FN2OS |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | N-[(4-cyanophenyl)methyl]-4-fluoro-3-methyl-1-benzothiophene-2-carboxamide |
| SMILES | Cc1c(C(=O)NCc2ccc(C#N)cc2)sc2cccc(F)c12 |
| InChI | InChI=1S/C18H13FN2OS/c1-11-16-14(19)3-2-4-15(16)23-17(11)18(22)21-10-13-7-5-12(9-20)6-8-13/h2-8H,10H2,1H3,(H,21,22) |
| InChIKey | OAAXVTKJNCLSDT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |