C16H19N3O2S — CID 134035733
1-[1-[[2-cyanoethyl(methyl)sulfamoyl]amino]ethyl]naphthalene (PubChem CID 134035733) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is 1-[1-[[2-cyanoethyl(methyl)sulfamoyl]amino]ethyl]naphthalene.
| Compound Name | 1-[1-[[2-cyanoethyl(methyl)sulfamoyl]amino]ethyl]naphthalene |
|---|---|
| PubChem CID | 134035733 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 1-[1-[[2-cyanoethyl(methyl)sulfamoyl]amino]ethyl]naphthalene |
| SMILES | CC(NS(=O)(=O)N(C)CCC#N)c1cccc2ccccc12 |
| InChI | InChI=1S/C16H19N3O2S/c1-13(18-22(20,21)19(2)12-6-11-17)15-10-5-8-14-7-3-4-9-16(14)15/h3-5,7-10,13,18H,6,12H2,1-2H3 |
| InChIKey | YMWNHYAJAPUOSS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |