C30H30N6O6 — CID 13403597
ethyl 4-[[4,6-bis(4-ethoxycarbonylanilino)-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 13403597) has the molecular formula C30H30N6O6 and a molecular weight of 570.61 g/mol. Its IUPAC name is ethyl 4-[[4,6-bis(4-ethoxycarbonylanilino)-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | ethyl 4-[[4,6-bis(4-ethoxycarbonylanilino)-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 13403597 |
| Molecular Formula | C30H30N6O6 |
| Molecular Weight | 570.61 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | ethyl 4-[[4,6-bis(4-ethoxycarbonylanilino)-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2nc(Nc3ccc(C(=O)OCC)cc3)nc(Nc3ccc(C(=O)OCC)cc3)n2)cc1 |
| InChI | InChI=1S/C30H30N6O6/c1-4-40-25(37)19-7-13-22(14-8-19)31-28-34-29(32-23-15-9-20(10-16-23)26(38)41-5-2)36-30(35-28)33-24-17-11-21(12-18-24)27(39)42-6-3/h7-18H,4-6H2,1-3H3,(H3,31,32,33,34,35,36) |
| InChIKey | UHGOHGRPESTFHC-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 153.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.61 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|