C18H14N4O3S — CID 134037519
N-[5-(1H-indazol-5-ylcarbamoyl)-4-methylthiophen-2-yl]furan-2-carboxamide (PubChem CID 134037519) has the molecular formula C18H14N4O3S and a molecular weight of 366.40 g/mol. Its IUPAC name is N-[5-(1H-indazol-5-ylcarbamoyl)-4-methylthiophen-2-yl]furan-2-carboxamide.
| Compound Name | N-[5-(1H-indazol-5-ylcarbamoyl)-4-methylthiophen-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 134037519 |
| Molecular Formula | C18H14N4O3S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | N-[5-(1H-indazol-5-ylcarbamoyl)-4-methylthiophen-2-yl]furan-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccco2)sc1C(=O)Nc1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C18H14N4O3S/c1-10-7-15(21-17(23)14-3-2-6-25-14)26-16(10)18(24)20-12-4-5-13-11(8-12)9-19-22-13/h2-9H,1H3,(H,19,22)(H,20,24)(H,21,23) |
| InChIKey | OCPDVIVRQRVUNR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |