C23H31FN4O — CID 134038231
N-[2-(dimethylamino)-2-phenylethyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]propanamide (PubChem CID 134038231) has the molecular formula C23H31FN4O and a molecular weight of 398.53 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-phenylethyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]propanamide.
| Compound Name | N-[2-(dimethylamino)-2-phenylethyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 134038231 |
| Molecular Formula | C23H31FN4O |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | N-[2-(dimethylamino)-2-phenylethyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]propanamide |
| SMILES | CC(C(=O)NCC(c1ccccc1)N(C)C)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H31FN4O/c1-18(23(29)25-17-22(26(2)3)19-7-5-4-6-8-19)27-13-15-28(16-14-27)21-11-9-20(24)10-12-21/h4-12,18,22H,13-17H2,1-3H3,(H,25,29) |
| InChIKey | TYHJSUWFCLORNG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |