C16H28N4O2S — CID 134038648
2-[[5-(2-cyclopentylethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxypropyl)propanamide (PubChem CID 134038648) has the molecular formula C16H28N4O2S and a molecular weight of 340.49 g/mol. Its IUPAC name is 2-[[5-(2-cyclopentylethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxypropyl)propanamide.
| Compound Name | 2-[[5-(2-cyclopentylethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxypropyl)propanamide |
|---|---|
| PubChem CID | 134038648 |
| Molecular Formula | C16H28N4O2S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 2-[[5-(2-cyclopentylethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxypropyl)propanamide |
| SMILES | COCCCNC(=O)C(C)Sc1n[nH]c(CCC2CCCC2)n1 |
| InChI | InChI=1S/C16H28N4O2S/c1-12(15(21)17-10-5-11-22-2)23-16-18-14(19-20-16)9-8-13-6-3-4-7-13/h12-13H,3-11H2,1-2H3,(H,17,21)(H,18,19,20) |
| InChIKey | KKFPFGLOINFXCD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|