C11H16O2 — CID 13403967
3,4,4a,5,7,8,9,9a-octahydro-2H-benzo[7]annulene-1,6-dione (PubChem CID 13403967) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 3,4,4a,5,7,8,9,9a-octahydro-2H-benzo[7]annulene-1,6-dione.
| Compound Name | 3,4,4a,5,7,8,9,9a-octahydro-2H-benzo[7]annulene-1,6-dione |
|---|---|
| PubChem CID | 13403967 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 3,4,4a,5,7,8,9,9a-octahydro-2H-benzo[7]annulene-1,6-dione |
| SMILES | O=C1CCCC2C(=O)CCCC2C1 |
| InChI | InChI=1S/C11H16O2/c12-9-4-2-5-10-8(7-9)3-1-6-11(10)13/h8,10H,1-7H2 |
| InChIKey | LTDGKSBIYDSHIH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |