About 4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]aniline
4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]aniline (PubChem CID 13404036) has the molecular formula C16H14N2O2
and a molecular weight of 266.30 g/mol. Its IUPAC name is 4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]aniline.
Molecular Properties
| Compound Name | 4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]aniline |
| PubChem CID | 13404036 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]aniline |
| SMILES | COc1ccc(-c2cnc(-c3ccc(N)cc3)o2)cc1 |
| InChI | InChI=1S/C16H14N2O2/c1-19-14-8-4-11(5-9-14)15-10-18-16(20-15)12-2-6-13(17)7-3-12/h2-10H,17H2,1H3 |
| InChIKey | AAQZLMTVPPRBEI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]aniline?
The IUPAC name of 4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]aniline (CID 13404036) is 4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]aniline.
What is the SMILES notation for 4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]aniline?
The canonical SMILES for 4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]aniline is COc1ccc(-c2cnc(-c3ccc(N)cc3)o2)cc1.
What is the InChIKey of 4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]aniline?
The InChIKey is AAQZLMTVPPRBEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O2/c1-19-14-8-4-11(5-9-14)15-10-18-16(20-15)12-2-6-13(17)7-3-12/h2-10H,17H2,1H3.
What are the key properties of 4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]aniline?
4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]aniline has a molecular weight of 266.30 g/mol, XLogP of 3.60, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]aniline is sourced from PubChem (CID 13404036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).