About 2,5-bis(4-methoxyphenyl)-1,3-oxazole
2,5-bis(4-methoxyphenyl)-1,3-oxazole (PubChem CID 13404049) has the molecular formula C17H15NO3
and a molecular weight of 281.31 g/mol. Its IUPAC name is 2,5-bis(4-methoxyphenyl)-1,3-oxazole.
Molecular Properties
| Compound Name | 2,5-bis(4-methoxyphenyl)-1,3-oxazole |
| PubChem CID | 13404049 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 2,5-bis(4-methoxyphenyl)-1,3-oxazole |
| SMILES | COc1ccc(-c2cnc(-c3ccc(OC)cc3)o2)cc1 |
| InChI | InChI=1S/C17H15NO3/c1-19-14-7-3-12(4-8-14)16-11-18-17(21-16)13-5-9-15(20-2)10-6-13/h3-11H,1-2H3 |
| InChIKey | NHNMUPTZVKPGEZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,5-bis(4-methoxyphenyl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(4-methoxyphenyl)-1,3-oxazole?
The IUPAC name of 2,5-bis(4-methoxyphenyl)-1,3-oxazole (CID 13404049) is 2,5-bis(4-methoxyphenyl)-1,3-oxazole.
What is the SMILES notation for 2,5-bis(4-methoxyphenyl)-1,3-oxazole?
The canonical SMILES for 2,5-bis(4-methoxyphenyl)-1,3-oxazole is COc1ccc(-c2cnc(-c3ccc(OC)cc3)o2)cc1.
What is the InChIKey of 2,5-bis(4-methoxyphenyl)-1,3-oxazole?
The InChIKey is NHNMUPTZVKPGEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO3/c1-19-14-7-3-12(4-8-14)16-11-18-17(21-16)13-5-9-15(20-2)10-6-13/h3-11H,1-2H3.
What are the key properties of 2,5-bis(4-methoxyphenyl)-1,3-oxazole?
2,5-bis(4-methoxyphenyl)-1,3-oxazole has a molecular weight of 281.31 g/mol, XLogP of 4.03, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(4-methoxyphenyl)-1,3-oxazole is sourced from PubChem (CID 13404049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).