C18H27BrN2O2 — CID 134041991
1-(3-bromoadamantane-1-carbonyl)-N-methylpiperidine-4-carboxamide (PubChem CID 134041991) has the molecular formula C18H27BrN2O2 and a molecular weight of 383.33 g/mol. Its IUPAC name is 1-(3-bromoadamantane-1-carbonyl)-N-methylpiperidine-4-carboxamide.
| Compound Name | 1-(3-bromoadamantane-1-carbonyl)-N-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 134041991 |
| Molecular Formula | C18H27BrN2O2 |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 1-(3-bromoadamantane-1-carbonyl)-N-methylpiperidine-4-carboxamide |
| SMILES | CNC(=O)C1CCN(C(=O)C23CC4CC(CC(Br)(C4)C2)C3)CC1 |
| InChI | InChI=1S/C18H27BrN2O2/c1-20-15(22)14-2-4-21(5-3-14)16(23)17-7-12-6-13(8-17)10-18(19,9-12)11-17/h12-14H,2-11H2,1H3,(H,20,22) |
| InChIKey | KMOMHNGSTHIEBC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|