C14H16N2S — CID 134042123
1-(3,4-dimethylphenyl)-2-prop-2-enylsulfanylimidazole (PubChem CID 134042123) has the molecular formula C14H16N2S and a molecular weight of 244.36 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-2-prop-2-enylsulfanylimidazole.
| Compound Name | 1-(3,4-dimethylphenyl)-2-prop-2-enylsulfanylimidazole |
|---|---|
| PubChem CID | 134042123 |
| Molecular Formula | C14H16N2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-2-prop-2-enylsulfanylimidazole |
| SMILES | C=CCSc1nccn1-c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C14H16N2S/c1-4-9-17-14-15-7-8-16(14)13-6-5-11(2)12(3)10-13/h4-8,10H,1,9H2,2-3H3 |
| InChIKey | WQWBAHCGIPRNFZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|