About 3-thiophen-2-yl-1,2-benzoxazole
3-thiophen-2-yl-1,2-benzoxazole (PubChem CID 13404236) has the molecular formula C11H7NOS
and a molecular weight of 201.25 g/mol. Its IUPAC name is 3-thiophen-2-yl-1,2-benzoxazole.
Molecular Properties
| Compound Name | 3-thiophen-2-yl-1,2-benzoxazole |
| PubChem CID | 13404236 |
| Molecular Formula | C11H7NOS |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | 3-thiophen-2-yl-1,2-benzoxazole |
| SMILES | c1csc(-c2noc3ccccc23)c1 |
| InChI | InChI=1S/C11H7NOS/c1-2-5-9-8(4-1)11(12-13-9)10-6-3-7-14-10/h1-7H |
| InChIKey | JHIPRDGDCCTDSQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-thiophen-2-yl-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-thiophen-2-yl-1,2-benzoxazole?
The IUPAC name of 3-thiophen-2-yl-1,2-benzoxazole (CID 13404236) is 3-thiophen-2-yl-1,2-benzoxazole.
What is the SMILES notation for 3-thiophen-2-yl-1,2-benzoxazole?
The canonical SMILES for 3-thiophen-2-yl-1,2-benzoxazole is c1csc(-c2noc3ccccc23)c1.
What is the InChIKey of 3-thiophen-2-yl-1,2-benzoxazole?
The InChIKey is JHIPRDGDCCTDSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7NOS/c1-2-5-9-8(4-1)11(12-13-9)10-6-3-7-14-10/h1-7H.
What are the key properties of 3-thiophen-2-yl-1,2-benzoxazole?
3-thiophen-2-yl-1,2-benzoxazole has a molecular weight of 201.25 g/mol, XLogP of 3.56, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-thiophen-2-yl-1,2-benzoxazole is sourced from PubChem (CID 13404236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).