C17H18ClN3O2S — CID 134042793
2-[(Z)-[amino-(3-chlorophenyl)methylidene]amino]oxy-N-(2-methylsulfanylphenyl)propanamide (PubChem CID 134042793) has the molecular formula C17H18ClN3O2S and a molecular weight of 363.87 g/mol. Its IUPAC name is 2-[(Z)-[amino-(3-chlorophenyl)methylidene]amino]oxy-N-(2-methylsulfanylphenyl)propanamide.
| Compound Name | 2-[(Z)-[amino-(3-chlorophenyl)methylidene]amino]oxy-N-(2-methylsulfanylphenyl)propanamide |
|---|---|
| PubChem CID | 134042793 |
| Molecular Formula | C17H18ClN3O2S |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 2-[(Z)-[amino-(3-chlorophenyl)methylidene]amino]oxy-N-(2-methylsulfanylphenyl)propanamide |
| SMILES | CSc1ccccc1NC(=O)C(C)O/N=C(\N)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H18ClN3O2S/c1-11(17(22)20-14-8-3-4-9-15(14)24-2)23-21-16(19)12-6-5-7-13(18)10-12/h3-11H,1-2H3,(H2,19,21)(H,20,22) |
| InChIKey | NLBOVKJYKBKERM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|