C20H14N2O4 — CID 134043010
(7-methoxynaphthalen-2-yl) 4-oxopyrido[1,2-a]pyrimidine-3-carboxylate (PubChem CID 134043010) has the molecular formula C20H14N2O4 and a molecular weight of 346.34 g/mol. Its IUPAC name is (7-methoxynaphthalen-2-yl) 4-oxopyrido[1,2-a]pyrimidine-3-carboxylate.
| Compound Name | (7-methoxynaphthalen-2-yl) 4-oxopyrido[1,2-a]pyrimidine-3-carboxylate |
|---|---|
| PubChem CID | 134043010 |
| Molecular Formula | C20H14N2O4 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | (7-methoxynaphthalen-2-yl) 4-oxopyrido[1,2-a]pyrimidine-3-carboxylate |
| SMILES | COc1ccc2ccc(OC(=O)c3cnc4ccccn4c3=O)cc2c1 |
| InChI | InChI=1S/C20H14N2O4/c1-25-15-7-5-13-6-8-16(11-14(13)10-15)26-20(24)17-12-21-18-4-2-3-9-22(18)19(17)23/h2-12H,1H3 |
| InChIKey | UEFHQTHJSNBHLR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|