About 2,5-dimethoxycyclohexa-1,3-diene
2,5-dimethoxycyclohexa-1,3-diene (PubChem CID 13404344) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is 2,5-dimethoxycyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 2,5-dimethoxycyclohexa-1,3-diene |
| PubChem CID | 13404344 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 2,5-dimethoxycyclohexa-1,3-diene |
| SMILES | COC1=CCC(OC)C=C1 |
| InChI | InChI=1S/C8H12O2/c1-9-7-3-5-8(10-2)6-4-7/h3-5,8H,6H2,1-2H3 |
| InChIKey | YYZNONMEYBVCCR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-dimethoxycyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethoxycyclohexa-1,3-diene?
The IUPAC name of 2,5-dimethoxycyclohexa-1,3-diene (CID 13404344) is 2,5-dimethoxycyclohexa-1,3-diene.
What is the SMILES notation for 2,5-dimethoxycyclohexa-1,3-diene?
The canonical SMILES for 2,5-dimethoxycyclohexa-1,3-diene is COC1=CCC(OC)C=C1.
What is the InChIKey of 2,5-dimethoxycyclohexa-1,3-diene?
The InChIKey is YYZNONMEYBVCCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2/c1-9-7-3-5-8(10-2)6-4-7/h3-5,8H,6H2,1-2H3.
What are the key properties of 2,5-dimethoxycyclohexa-1,3-diene?
2,5-dimethoxycyclohexa-1,3-diene has a molecular weight of 140.18 g/mol, XLogP of 1.49, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethoxycyclohexa-1,3-diene is sourced from PubChem (CID 13404344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).