C17H21FN4O3 — CID 134044506
2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]-N-(2-fluoro-5-nitrophenyl)acetamide (PubChem CID 134044506) has the molecular formula C17H21FN4O3 and a molecular weight of 348.38 g/mol. Its IUPAC name is 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]-N-(2-fluoro-5-nitrophenyl)acetamide.
| Compound Name | 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]-N-(2-fluoro-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 134044506 |
| Molecular Formula | C17H21FN4O3 |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]-N-(2-fluoro-5-nitrophenyl)acetamide |
| SMILES | Cc1nn(CC(C)C)c(C)c1CC(=O)Nc1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C17H21FN4O3/c1-10(2)9-21-12(4)14(11(3)20-21)8-17(23)19-16-7-13(22(24)25)5-6-15(16)18/h5-7,10H,8-9H2,1-4H3,(H,19,23) |
| InChIKey | RVGMLDXXDDTLIU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|