C22H35N3O2 — CID 134045311
N-heptan-2-yl-2-[4-(3-methylbenzoyl)-1,4-diazepan-1-yl]acetamide (PubChem CID 134045311) has the molecular formula C22H35N3O2 and a molecular weight of 373.54 g/mol. Its IUPAC name is N-heptan-2-yl-2-[4-(3-methylbenzoyl)-1,4-diazepan-1-yl]acetamide.
| Compound Name | N-heptan-2-yl-2-[4-(3-methylbenzoyl)-1,4-diazepan-1-yl]acetamide |
|---|---|
| PubChem CID | 134045311 |
| Molecular Formula | C22H35N3O2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.27 |
| IUPAC Name | N-heptan-2-yl-2-[4-(3-methylbenzoyl)-1,4-diazepan-1-yl]acetamide |
| SMILES | CCCCCC(C)NC(=O)CN1CCCN(C(=O)c2cccc(C)c2)CC1 |
| InChI | InChI=1S/C22H35N3O2/c1-4-5-6-10-19(3)23-21(26)17-24-12-8-13-25(15-14-24)22(27)20-11-7-9-18(2)16-20/h7,9,11,16,19H,4-6,8,10,12-15,17H2,1-3H3,(H,23,26) |
| InChIKey | XEDOLRCEKFNPQX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|