C19H18N4O2S — CID 134046181
N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-2-(1-phenylpyrazol-4-yl)acetamide (PubChem CID 134046181) has the molecular formula C19H18N4O2S and a molecular weight of 366.45 g/mol. Its IUPAC name is N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-2-(1-phenylpyrazol-4-yl)acetamide.
| Compound Name | N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-2-(1-phenylpyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 134046181 |
| Molecular Formula | C19H18N4O2S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-2-(1-phenylpyrazol-4-yl)acetamide |
| SMILES | NC(=O)CSc1ccccc1NC(=O)Cc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C19H18N4O2S/c20-18(24)13-26-17-9-5-4-8-16(17)22-19(25)10-14-11-21-23(12-14)15-6-2-1-3-7-15/h1-9,11-12H,10,13H2,(H2,20,24)(H,22,25) |
| InChIKey | FNIMXXBUDJKRIG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |