C19H24N4O3 — CID 134046699
4-(3-methyl-1,2,4-oxadiazol-5-yl)-N-[3-(2-oxoazepan-1-yl)propyl]benzamide (PubChem CID 134046699) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is 4-(3-methyl-1,2,4-oxadiazol-5-yl)-N-[3-(2-oxoazepan-1-yl)propyl]benzamide.
| Compound Name | 4-(3-methyl-1,2,4-oxadiazol-5-yl)-N-[3-(2-oxoazepan-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 134046699 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 4-(3-methyl-1,2,4-oxadiazol-5-yl)-N-[3-(2-oxoazepan-1-yl)propyl]benzamide |
| SMILES | Cc1noc(-c2ccc(C(=O)NCCCN3CCCCCC3=O)cc2)n1 |
| InChI | InChI=1S/C19H24N4O3/c1-14-21-19(26-22-14)16-9-7-15(8-10-16)18(25)20-11-5-13-23-12-4-2-3-6-17(23)24/h7-10H,2-6,11-13H2,1H3,(H,20,25) |
| InChIKey | WTTPMXKLOUQSAZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|