C17H13Cl2N5O3 — CID 134046812
N-(4-amino-3,5-dichlorophenyl)-1-cyclopropyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide (PubChem CID 134046812) has the molecular formula C17H13Cl2N5O3 and a molecular weight of 406.23 g/mol. Its IUPAC name is N-(4-amino-3,5-dichlorophenyl)-1-cyclopropyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-(4-amino-3,5-dichlorophenyl)-1-cyclopropyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 134046812 |
| Molecular Formula | C17H13Cl2N5O3 |
| Molecular Weight | 406.23 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | N-(4-amino-3,5-dichlorophenyl)-1-cyclopropyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Nc1c(Cl)cc(NC(=O)c2cnc3c(c2)c(=O)[nH]c(=O)n3C2CC2)cc1Cl |
| InChI | InChI=1S/C17H13Cl2N5O3/c18-11-4-8(5-12(19)13(11)20)22-15(25)7-3-10-14(21-6-7)24(9-1-2-9)17(27)23-16(10)26/h3-6,9H,1-2,20H2,(H,22,25)(H,23,26,27) |
| InChIKey | HQJAXDOVLHOMDJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 122.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.23 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|