C25H34N4O2 — CID 134049407
3-acetamido-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-3-(4-methylphenyl)propanamide (PubChem CID 134049407) has the molecular formula C25H34N4O2 and a molecular weight of 422.57 g/mol. Its IUPAC name is 3-acetamido-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-3-(4-methylphenyl)propanamide.
| Compound Name | 3-acetamido-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-3-(4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 134049407 |
| Molecular Formula | C25H34N4O2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 3-acetamido-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-3-(4-methylphenyl)propanamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)CC(NC(C)=O)c3ccc(C)cc3)c(C)c2)CC1 |
| InChI | InChI=1S/C25H34N4O2/c1-5-28-12-14-29(15-13-28)22-10-11-23(19(3)16-22)27-25(31)17-24(26-20(4)30)21-8-6-18(2)7-9-21/h6-11,16,24H,5,12-15,17H2,1-4H3,(H,26,30)(H,27,31) |
| InChIKey | ODHGRWHSIRKOCQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|