C26H33N5OS — CID 134049483
N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-2-[4-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]acetamide (PubChem CID 134049483) has the molecular formula C26H33N5OS and a molecular weight of 463.65 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-2-[4-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]acetamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-2-[4-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 134049483 |
| Molecular Formula | C26H33N5OS |
| Molecular Weight | 463.65 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-2-[4-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]acetamide |
| SMILES | CN(Cc1ccc(N(C)C)cc1)C(=O)CN1CCN(Cc2csc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C26H33N5OS/c1-28(2)24-11-9-21(10-12-24)17-29(3)25(32)19-31-15-13-30(14-16-31)18-23-20-33-26(27-23)22-7-5-4-6-8-22/h4-12,20H,13-19H2,1-3H3 |
| InChIKey | UZINMDFLQVXIHT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 42.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.65 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|