C16H15N3O3S — CID 134050321
methyl 5-[(1-methylbenzimidazol-2-yl)methylcarbamoyl]thiophene-2-carboxylate (PubChem CID 134050321) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is methyl 5-[(1-methylbenzimidazol-2-yl)methylcarbamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[(1-methylbenzimidazol-2-yl)methylcarbamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 134050321 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | methyl 5-[(1-methylbenzimidazol-2-yl)methylcarbamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(=O)NCc2nc3ccccc3n2C)s1 |
| InChI | InChI=1S/C16H15N3O3S/c1-19-11-6-4-3-5-10(11)18-14(19)9-17-15(20)12-7-8-13(23-12)16(21)22-2/h3-8H,9H2,1-2H3,(H,17,20) |
| InChIKey | ZOFBOWPJVBLLSZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |